About 3-[(4-ethyl-3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-pyrrolo[3,2-b]pyridin-2-one
3-[(4-ethyl-3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-pyrrolo[3,2-b]pyridin-2-one (PubChem CID 56978902) has the molecular formula C16H17N3O
and a molecular weight of 267.33 g/mol. Its IUPAC name is 3-[(4-ethyl-3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-pyrrolo[3,2-b]pyridin-2-one.
Molecular Properties
| Compound Name | 3-[(4-ethyl-3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-pyrrolo[3,2-b]pyridin-2-one |
| PubChem CID | 56978902 |
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 3-[(4-ethyl-3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-pyrrolo[3,2-b]pyridin-2-one |
| SMILES | CCc1c(C)[nH]c(C=C2C(=O)Nc3cccnc32)c1C |
| InChI | InChI=1S/C16H17N3O/c1-4-11-9(2)14(18-10(11)3)8-12-15-13(19-16(12)20)6-5-7-17-15/h5-8,18H,4H2,1-3H3,(H,19,20) |
| InChIKey | ZSVHQYPEFQQFBO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4-ethyl-3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-pyrrolo[3,2-b]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-ethyl-3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-pyrrolo[3,2-b]pyridin-2-one?
The IUPAC name of 3-[(4-ethyl-3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-pyrrolo[3,2-b]pyridin-2-one (CID 56978902) is 3-[(4-ethyl-3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-pyrrolo[3,2-b]pyridin-2-one.
What is the SMILES notation for 3-[(4-ethyl-3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-pyrrolo[3,2-b]pyridin-2-one?
The canonical SMILES for 3-[(4-ethyl-3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-pyrrolo[3,2-b]pyridin-2-one is CCc1c(C)[nH]c(C=C2C(=O)Nc3cccnc32)c1C.
What is the InChIKey of 3-[(4-ethyl-3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-pyrrolo[3,2-b]pyridin-2-one?
The InChIKey is ZSVHQYPEFQQFBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O/c1-4-11-9(2)14(18-10(11)3)8-12-15-13(19-16(12)20)6-5-7-17-15/h5-8,18H,4H2,1-3H3,(H,19,20).
What are the key properties of 3-[(4-ethyl-3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-pyrrolo[3,2-b]pyridin-2-one?
3-[(4-ethyl-3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-pyrrolo[3,2-b]pyridin-2-one has a molecular weight of 267.33 g/mol, XLogP of 3.08, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-ethyl-3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-pyrrolo[3,2-b]pyridin-2-one is sourced from PubChem (CID 56978902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).