C22H36N6O4S+2 — CID 56978911
2-[(4S)-4-amino-5-[2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethoxy]-5-oxopentanoyl]oxyethyl-trimethylazanium (PubChem CID 56978911) has the molecular formula C22H36N6O4S+2 and a molecular weight of 480.64 g/mol. Its IUPAC name is 2-[(4S)-4-amino-5-[2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethoxy]-5-oxopentanoyl]oxyethyl-trimethylazanium.
| Compound Name | 2-[(4S)-4-amino-5-[2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethoxy]-5-oxopentanoyl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 56978911 |
| Molecular Formula | C22H36N6O4S+2 |
| Molecular Weight | 480.64 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | 2-[(4S)-4-amino-5-[2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethoxy]-5-oxopentanoyl]oxyethyl-trimethylazanium |
| SMILES | Cc1ncc(C[n+]2csc(CCOC(=O)[C@@H](N)CCC(=O)OCC[N+](C)(C)C)c2C)c(N)n1 |
| InChI | InChI=1S/C22H36N6O4S/c1-15-19(33-14-27(15)13-17-12-25-16(2)26-21(17)24)8-10-32-22(30)18(23)6-7-20(29)31-11-9-28(3,4)5/h12,14,18H,6-11,13,23H2,1-5H3,(H2,24,25,26)/q+2/t18-/m0/s1 |
| InChIKey | DVBDHXBQIGDVQJ-SFHVURJKSA-N |
| XLogP | 0.52 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.64 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|