About (4-cyanoimino-2,5-diethylcyclohexa-2,5-dien-1-ylidene)cyanamide
(4-cyanoimino-2,5-diethylcyclohexa-2,5-dien-1-ylidene)cyanamide (PubChem CID 56979397) has the molecular formula C12H12N4
and a molecular weight of 212.26 g/mol. Its IUPAC name is (4-cyanoimino-2,5-diethylcyclohexa-2,5-dien-1-ylidene)cyanamide.
Molecular Properties
| Compound Name | (4-cyanoimino-2,5-diethylcyclohexa-2,5-dien-1-ylidene)cyanamide |
| PubChem CID | 56979397 |
| Molecular Formula | C12H12N4 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | (4-cyanoimino-2,5-diethylcyclohexa-2,5-dien-1-ylidene)cyanamide |
| SMILES | CCC1=C/C(=N\C#N)C(CC)=C/C1=N\C#N |
| InChI | InChI=1S/C12H12N4/c1-3-9-5-12(16-8-14)10(4-2)6-11(9)15-7-13/h5-6H,3-4H2,1-2H3/b15-11+,16-12+ |
| InChIKey | SKULUKBAHIQKSO-JOBJLJCHSA-N |
| XLogP | 2.52 |
| TPSA | 72.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (4-cyanoimino-2,5-diethylcyclohexa-2,5-dien-1-ylidene)cyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyanoimino-2,5-diethylcyclohexa-2,5-dien-1-ylidene)cyanamide?
The IUPAC name of (4-cyanoimino-2,5-diethylcyclohexa-2,5-dien-1-ylidene)cyanamide (CID 56979397) is (4-cyanoimino-2,5-diethylcyclohexa-2,5-dien-1-ylidene)cyanamide.
What is the SMILES notation for (4-cyanoimino-2,5-diethylcyclohexa-2,5-dien-1-ylidene)cyanamide?
The canonical SMILES for (4-cyanoimino-2,5-diethylcyclohexa-2,5-dien-1-ylidene)cyanamide is CCC1=C/C(=N\C#N)C(CC)=C/C1=N\C#N.
What is the InChIKey of (4-cyanoimino-2,5-diethylcyclohexa-2,5-dien-1-ylidene)cyanamide?
The InChIKey is SKULUKBAHIQKSO-JOBJLJCHSA-N. The full InChI is InChI=1S/C12H12N4/c1-3-9-5-12(16-8-14)10(4-2)6-11(9)15-7-13/h5-6H,3-4H2,1-2H3/b15-11+,16-12+.
What are the key properties of (4-cyanoimino-2,5-diethylcyclohexa-2,5-dien-1-ylidene)cyanamide?
(4-cyanoimino-2,5-diethylcyclohexa-2,5-dien-1-ylidene)cyanamide has a molecular weight of 212.26 g/mol, XLogP of 2.52, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyanoimino-2,5-diethylcyclohexa-2,5-dien-1-ylidene)cyanamide is sourced from PubChem (CID 56979397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).