C24H39NO6 — CID 56979432
8-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]oct-6-en-2-yl N-acetylcarbamate (PubChem CID 56979432) has the molecular formula C24H39NO6 and a molecular weight of 437.58 g/mol. Its IUPAC name is 8-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]oct-6-en-2-yl N-acetylcarbamate.
| Compound Name | 8-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]oct-6-en-2-yl N-acetylcarbamate |
|---|---|
| PubChem CID | 56979432 |
| Molecular Formula | C24H39NO6 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | 8-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]oct-6-en-2-yl N-acetylcarbamate |
| SMILES | CCCCC[C@H](O)C=C[C@H]1[C@H](O)CC(=O)[C@@H]1CC=CCCCC(C)OC(=O)NC(C)=O |
| InChI | InChI=1S/C24H39NO6/c1-4-5-8-12-19(27)14-15-21-20(22(28)16-23(21)29)13-10-7-6-9-11-17(2)31-24(30)25-18(3)26/h7,10,14-15,17,19-21,23,27,29H,4-6,8-9,11-13,16H2,1-3H3,(H,25,26,30)/t17?,19-,20+,21+,23+/m0/s1 |
| InChIKey | FANPFPBBJKPESO-NPIFQOSUSA-N |
| XLogP | 3.83 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|