C19H23FNO5S+ — CID 56979637
(1R)-1-[(3S)-3-acetylsulfanyl-4-(3-fluorophenyl)-2-methyl-4-oxobutanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 56979637) has the molecular formula C19H23FNO5S+ and a molecular weight of 396.46 g/mol. Its IUPAC name is (1R)-1-[(3S)-3-acetylsulfanyl-4-(3-fluorophenyl)-2-methyl-4-oxobutanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (1R)-1-[(3S)-3-acetylsulfanyl-4-(3-fluorophenyl)-2-methyl-4-oxobutanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 56979637 |
| Molecular Formula | C19H23FNO5S+ |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | (1R)-1-[(3S)-3-acetylsulfanyl-4-(3-fluorophenyl)-2-methyl-4-oxobutanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | CC(=O)S[C@H](C(=O)c1cccc(F)c1)C(C)C(=O)[N@@+]1(C(=O)O)CCCC1C |
| InChI | InChI=1S/C19H22FNO5S/c1-11-6-5-9-21(11,19(25)26)18(24)12(2)17(27-13(3)22)16(23)14-7-4-8-15(20)10-14/h4,7-8,10-12,17H,5-6,9H2,1-3H3/p+1/t11?,12?,17-,21+/m0/s1 |
| InChIKey | SKGPVFLVSLCVAX-OUQBATIESA-O |
| XLogP | 3.50 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|