About ethyl 2-[(1R,3S)-3-[3-[tert-butyl(dimethyl)silyl]oxyundec-1-enyl]-1-hydroxycyclohexyl]acetate
ethyl 2-[(1R,3S)-3-[3-[tert-butyl(dimethyl)silyl]oxyundec-1-enyl]-1-hydroxycyclohexyl]acetate (PubChem CID 56979918) has the molecular formula C27H52O4Si
and a molecular weight of 468.80 g/mol. Its IUPAC name is ethyl 2-[(1R,3S)-3-[3-[tert-butyl(dimethyl)silyl]oxyundec-1-enyl]-1-hydroxycyclohexyl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[(1R,3S)-3-[3-[tert-butyl(dimethyl)silyl]oxyundec-1-enyl]-1-hydroxycyclohexyl]acetate |
| PubChem CID | 56979918 |
| Molecular Formula | C27H52O4Si |
| Molecular Weight | 468.80 g/mol |
| Exact Mass | 468.36 |
| IUPAC Name | ethyl 2-[(1R,3S)-3-[3-[tert-butyl(dimethyl)silyl]oxyundec-1-enyl]-1-hydroxycyclohexyl]acetate |
| SMILES | CCCCCCCCC(C=C[C@H]1CCC[C@](O)(CC(=O)OCC)C1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H52O4Si/c1-8-10-11-12-13-14-17-24(31-32(6,7)26(3,4)5)19-18-23-16-15-20-27(29,21-23)22-25(28)30-9-2/h18-19,23-24,29H,8-17,20-22H2,1-7H3/t23-,24?,27-/m1/s1 |
| InChIKey | DSHNWAOHQIBVOG-GJQXLMDHSA-N |
| XLogP | 7.56 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.80 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[(1R,3S)-3-[3-[tert-butyl(dimethyl)silyl]oxyundec-1-enyl]-1-hydroxycyclohexyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(1R,3S)-3-[3-[tert-butyl(dimethyl)silyl]oxyundec-1-enyl]-1-hydroxycyclohexyl]acetate?
The IUPAC name of ethyl 2-[(1R,3S)-3-[3-[tert-butyl(dimethyl)silyl]oxyundec-1-enyl]-1-hydroxycyclohexyl]acetate (CID 56979918) is ethyl 2-[(1R,3S)-3-[3-[tert-butyl(dimethyl)silyl]oxyundec-1-enyl]-1-hydroxycyclohexyl]acetate.
What is the SMILES notation for ethyl 2-[(1R,3S)-3-[3-[tert-butyl(dimethyl)silyl]oxyundec-1-enyl]-1-hydroxycyclohexyl]acetate?
The canonical SMILES for ethyl 2-[(1R,3S)-3-[3-[tert-butyl(dimethyl)silyl]oxyundec-1-enyl]-1-hydroxycyclohexyl]acetate is CCCCCCCCC(C=C[C@H]1CCC[C@](O)(CC(=O)OCC)C1)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of ethyl 2-[(1R,3S)-3-[3-[tert-butyl(dimethyl)silyl]oxyundec-1-enyl]-1-hydroxycyclohexyl]acetate?
The InChIKey is DSHNWAOHQIBVOG-GJQXLMDHSA-N. The full InChI is InChI=1S/C27H52O4Si/c1-8-10-11-12-13-14-17-24(31-32(6,7)26(3,4)5)19-18-23-16-15-20-27(29,21-23)22-25(28)30-9-2/h18-19,23-24,29H,8-17,20-22H2,1-7H3/t23-,24?,27-/m1/s1.
What are the key properties of ethyl 2-[(1R,3S)-3-[3-[tert-butyl(dimethyl)silyl]oxyundec-1-enyl]-1-hydroxycyclohexyl]acetate?
ethyl 2-[(1R,3S)-3-[3-[tert-butyl(dimethyl)silyl]oxyundec-1-enyl]-1-hydroxycyclohexyl]acetate has a molecular weight of 468.80 g/mol, XLogP of 7.56, 14 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(1R,3S)-3-[3-[tert-butyl(dimethyl)silyl]oxyundec-1-enyl]-1-hydroxycyclohexyl]acetate is sourced from PubChem (CID 56979918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).