C9H12F2N6O2 — CID 56980282
[(2S,5S)-5-(4-amino-3aH-triazolo[4,5-d]pyrimidin-1-yl)-4,4-difluorooxolan-2-yl]methanol (PubChem CID 56980282) has the molecular formula C9H12F2N6O2 and a molecular weight of 274.23 g/mol. Its IUPAC name is [(2S,5S)-5-(4-amino-3aH-triazolo[4,5-d]pyrimidin-1-yl)-4,4-difluorooxolan-2-yl]methanol.
| Compound Name | [(2S,5S)-5-(4-amino-3aH-triazolo[4,5-d]pyrimidin-1-yl)-4,4-difluorooxolan-2-yl]methanol |
|---|---|
| PubChem CID | 56980282 |
| Molecular Formula | C9H12F2N6O2 |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | [(2S,5S)-5-(4-amino-3aH-triazolo[4,5-d]pyrimidin-1-yl)-4,4-difluorooxolan-2-yl]methanol |
| SMILES | NN1C=NC=C2C1N=NN2[C@H]1O[C@H](CO)CC1(F)F |
| InChI | InChI=1S/C9H12F2N6O2/c10-9(11)1-5(3-18)19-8(9)17-6-2-13-4-16(12)7(6)14-15-17/h2,4-5,7-8,18H,1,3,12H2/t5-,7?,8-/m0/s1 |
| InChIKey | ZYWOSRSLTSRPQK-PZICIZFRSA-N |
| XLogP | -0.20 |
| TPSA | 99.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|