C19H34O8 — CID 56980484
3-[(1S,2S,3S,5R)-2-[(R)-3,4-dihydroxybutoxy(methoxy)methyl]-5-hydroxy-3-(oxan-4-yloxy)cyclopentyl]propanal (PubChem CID 56980484) has the molecular formula C19H34O8 and a molecular weight of 390.47 g/mol. Its IUPAC name is 3-[(1S,2S,3S,5R)-2-[(R)-3,4-dihydroxybutoxy(methoxy)methyl]-5-hydroxy-3-(oxan-4-yloxy)cyclopentyl]propanal.
| Compound Name | 3-[(1S,2S,3S,5R)-2-[(R)-3,4-dihydroxybutoxy(methoxy)methyl]-5-hydroxy-3-(oxan-4-yloxy)cyclopentyl]propanal |
|---|---|
| PubChem CID | 56980484 |
| Molecular Formula | C19H34O8 |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | 3-[(1S,2S,3S,5R)-2-[(R)-3,4-dihydroxybutoxy(methoxy)methyl]-5-hydroxy-3-(oxan-4-yloxy)cyclopentyl]propanal |
| SMILES | CO[C@H](OCCC(O)CO)[C@H]1[C@H](CCC=O)[C@H](O)C[C@@H]1OC1CCOCC1 |
| InChI | InChI=1S/C19H34O8/c1-24-19(26-10-4-13(22)12-21)18-15(3-2-7-20)16(23)11-17(18)27-14-5-8-25-9-6-14/h7,13-19,21-23H,2-6,8-12H2,1H3/t13?,15-,16-,17+,18+,19-/m1/s1 |
| InChIKey | PVFPZFZWLDTLGH-RUNXHEPMSA-N |
| XLogP | 0.26 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|