About 2-(4-methyl-2H-1,3-thiazol-3-yl)acetamide
2-(4-methyl-2H-1,3-thiazol-3-yl)acetamide (PubChem CID 56980528) has the molecular formula C6H10N2OS
and a molecular weight of 158.23 g/mol. Its IUPAC name is 2-(4-methyl-2H-1,3-thiazol-3-yl)acetamide.
Molecular Properties
| Compound Name | 2-(4-methyl-2H-1,3-thiazol-3-yl)acetamide |
| PubChem CID | 56980528 |
| Molecular Formula | C6H10N2OS |
| Molecular Weight | 158.23 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | 2-(4-methyl-2H-1,3-thiazol-3-yl)acetamide |
| SMILES | CC1=CSCN1CC(N)=O |
| InChI | InChI=1S/C6H10N2OS/c1-5-3-10-4-8(5)2-6(7)9/h3H,2,4H2,1H3,(H2,7,9) |
| InChIKey | SSXAYXDAGCMOCB-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.23 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-methyl-2H-1,3-thiazol-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methyl-2H-1,3-thiazol-3-yl)acetamide?
The IUPAC name of 2-(4-methyl-2H-1,3-thiazol-3-yl)acetamide (CID 56980528) is 2-(4-methyl-2H-1,3-thiazol-3-yl)acetamide.
What is the SMILES notation for 2-(4-methyl-2H-1,3-thiazol-3-yl)acetamide?
The canonical SMILES for 2-(4-methyl-2H-1,3-thiazol-3-yl)acetamide is CC1=CSCN1CC(N)=O.
What is the InChIKey of 2-(4-methyl-2H-1,3-thiazol-3-yl)acetamide?
The InChIKey is SSXAYXDAGCMOCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2OS/c1-5-3-10-4-8(5)2-6(7)9/h3H,2,4H2,1H3,(H2,7,9).
What are the key properties of 2-(4-methyl-2H-1,3-thiazol-3-yl)acetamide?
2-(4-methyl-2H-1,3-thiazol-3-yl)acetamide has a molecular weight of 158.23 g/mol, XLogP of 0.34, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-2H-1,3-thiazol-3-yl)acetamide is sourced from PubChem (CID 56980528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).