C43H38N6O — CID 56981104
2-ethyl-4-[[4-phenyl-3-(2-trityltetrazol-5-yl)phenyl]methoxy]-5,6,7,8-tetrahydro-1,6-naphthyridine (PubChem CID 56981104) has the molecular formula C43H38N6O and a molecular weight of 654.82 g/mol. Its IUPAC name is 2-ethyl-4-[[4-phenyl-3-(2-trityltetrazol-5-yl)phenyl]methoxy]-5,6,7,8-tetrahydro-1,6-naphthyridine.
| Compound Name | 2-ethyl-4-[[4-phenyl-3-(2-trityltetrazol-5-yl)phenyl]methoxy]-5,6,7,8-tetrahydro-1,6-naphthyridine |
|---|---|
| PubChem CID | 56981104 |
| Molecular Formula | C43H38N6O |
| Molecular Weight | 654.82 g/mol |
| Exact Mass | 654.31 |
| IUPAC Name | 2-ethyl-4-[[4-phenyl-3-(2-trityltetrazol-5-yl)phenyl]methoxy]-5,6,7,8-tetrahydro-1,6-naphthyridine |
| SMILES | CCc1cc(OCc2ccc(-c3ccccc3)c(-c3nnn(C(c4ccccc4)(c4ccccc4)c4ccccc4)n3)c2)c2c(n1)CCNC2 |
| InChI | InChI=1S/C43H38N6O/c1-2-36-28-41(39-29-44-26-25-40(39)45-36)50-30-31-23-24-37(32-15-7-3-8-16-32)38(27-31)42-46-48-49(47-42)43(33-17-9-4-10-18-33,34-19-11-5-12-20-34)35-21-13-6-14-22-35/h3-24,27-28,44H,2,25-26,29-30H2,1H3 |
| InChIKey | LMSYXVBGMHMAEV-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.82 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|