C8H12F3NO4 — CID 56981156
N-[(2R,3R,4R,6S)-4,6-dihydroxy-2-methyloxan-3-yl]-2,2,2-trifluoroacetamide (PubChem CID 56981156) has the molecular formula C8H12F3NO4 and a molecular weight of 243.18 g/mol. Its IUPAC name is N-[(2R,3R,4R,6S)-4,6-dihydroxy-2-methyloxan-3-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(2R,3R,4R,6S)-4,6-dihydroxy-2-methyloxan-3-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 56981156 |
| Molecular Formula | C8H12F3NO4 |
| Molecular Weight | 243.18 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | N-[(2R,3R,4R,6S)-4,6-dihydroxy-2-methyloxan-3-yl]-2,2,2-trifluoroacetamide |
| SMILES | C[C@H]1O[C@H](O)C[C@@H](O)[C@H]1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C8H12F3NO4/c1-3-6(4(13)2-5(14)16-3)12-7(15)8(9,10)11/h3-6,13-14H,2H2,1H3,(H,12,15)/t3-,4-,5+,6+/m1/s1 |
| InChIKey | YNHAAFBYSJFTRR-ZXXMMSQZSA-N |
| XLogP | -0.48 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.18 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |