C11H12N2 — CID 56981217
2,3,4,4a-tetrahydro-1H-pyrido[4,3-b]indole (PubChem CID 56981217) has the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 2,3,4,4a-tetrahydro-1H-pyrido[4,3-b]indole.
| Compound Name | 2,3,4,4a-tetrahydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 56981217 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 2,3,4,4a-tetrahydro-1H-pyrido[4,3-b]indole |
| SMILES | c1ccc2c(c1)=NC1CCNCC=21 |
| InChI | InChI=1S/C11H12N2/c1-2-4-10-8(3-1)9-7-12-6-5-11(9)13-10/h1-4,11-12H,5-7H2 |
| InChIKey | ZRGIHRLCJVIUNZ-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |