C22H28FNO4 — CID 56981396
4-[[(3aR,4S,5S,6aR)-4-[4-(4-fluorophenoxy)-3-hydroxybut-1-enyl]-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]oxy]butanenitrile (PubChem CID 56981396) has the molecular formula C22H28FNO4 and a molecular weight of 389.47 g/mol. Its IUPAC name is 4-[[(3aR,4S,5S,6aR)-4-[4-(4-fluorophenoxy)-3-hydroxybut-1-enyl]-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]oxy]butanenitrile.
| Compound Name | 4-[[(3aR,4S,5S,6aR)-4-[4-(4-fluorophenoxy)-3-hydroxybut-1-enyl]-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]oxy]butanenitrile |
|---|---|
| PubChem CID | 56981396 |
| Molecular Formula | C22H28FNO4 |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 4-[[(3aR,4S,5S,6aR)-4-[4-(4-fluorophenoxy)-3-hydroxybut-1-enyl]-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]oxy]butanenitrile |
| SMILES | N#CCCCOC1C[C@H]2C[C@H](O)[C@@H](C=CC(O)COc3ccc(F)cc3)[C@@H]2C1 |
| InChI | InChI=1S/C22H28FNO4/c23-16-3-6-18(7-4-16)28-14-17(25)5-8-20-21-13-19(27-10-2-1-9-24)11-15(21)12-22(20)26/h3-8,15,17,19-22,25-26H,1-2,10-14H2/t15-,17?,19?,20-,21+,22-/m0/s1 |
| InChIKey | GLRHNEZMNQBSCL-JRLBJBOESA-N |
| XLogP | 3.22 |
| TPSA | 82.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|