C16H14F5N3O4 — CID 56981405
ethyl 3-methyl-5-(3-nitrophenyl)-6-(1,1,2,2,2-pentafluoroethyl)-4,5-dihydropyridazine-4-carboxylate (PubChem CID 56981405) has the molecular formula C16H14F5N3O4 and a molecular weight of 407.30 g/mol. Its IUPAC name is ethyl 3-methyl-5-(3-nitrophenyl)-6-(1,1,2,2,2-pentafluoroethyl)-4,5-dihydropyridazine-4-carboxylate.
| Compound Name | ethyl 3-methyl-5-(3-nitrophenyl)-6-(1,1,2,2,2-pentafluoroethyl)-4,5-dihydropyridazine-4-carboxylate |
|---|---|
| PubChem CID | 56981405 |
| Molecular Formula | C16H14F5N3O4 |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | ethyl 3-methyl-5-(3-nitrophenyl)-6-(1,1,2,2,2-pentafluoroethyl)-4,5-dihydropyridazine-4-carboxylate |
| SMILES | CCOC(=O)C1C(C)=NN=C(C(F)(F)C(F)(F)F)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H14F5N3O4/c1-3-28-14(25)11-8(2)22-23-13(15(17,18)16(19,20)21)12(11)9-5-4-6-10(7-9)24(26)27/h4-7,11-12H,3H2,1-2H3 |
| InChIKey | AAIFXGBKKOLYKX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 94.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|