About prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(3-hydroxyprop-1-enyl)pyrrolidine-1-carboxylate
prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(3-hydroxyprop-1-enyl)pyrrolidine-1-carboxylate (PubChem CID 56981485) has the molecular formula C17H31NO4Si
and a molecular weight of 341.52 g/mol. Its IUPAC name is prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(3-hydroxyprop-1-enyl)pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(3-hydroxyprop-1-enyl)pyrrolidine-1-carboxylate |
| PubChem CID | 56981485 |
| Molecular Formula | C17H31NO4Si |
| Molecular Weight | 341.52 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(3-hydroxyprop-1-enyl)pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C=CCO |
| InChI | InChI=1S/C17H31NO4Si/c1-7-11-21-16(20)18-13-15(12-14(18)9-8-10-19)22-23(5,6)17(2,3)4/h7-9,14-15,19H,1,10-13H2,2-6H3/t14-,15-/m1/s1 |
| InChIKey | HUYVROIITHOCHX-HUUCEWRRSA-N |
| XLogP | 3.32 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.52 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(3-hydroxyprop-1-enyl)pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(3-hydroxyprop-1-enyl)pyrrolidine-1-carboxylate?
The IUPAC name of prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(3-hydroxyprop-1-enyl)pyrrolidine-1-carboxylate (CID 56981485) is prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(3-hydroxyprop-1-enyl)pyrrolidine-1-carboxylate.
What is the SMILES notation for prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(3-hydroxyprop-1-enyl)pyrrolidine-1-carboxylate?
The canonical SMILES for prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(3-hydroxyprop-1-enyl)pyrrolidine-1-carboxylate is C=CCOC(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C=CCO.
What is the InChIKey of prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(3-hydroxyprop-1-enyl)pyrrolidine-1-carboxylate?
The InChIKey is HUYVROIITHOCHX-HUUCEWRRSA-N. The full InChI is InChI=1S/C17H31NO4Si/c1-7-11-21-16(20)18-13-15(12-14(18)9-8-10-19)22-23(5,6)17(2,3)4/h7-9,14-15,19H,1,10-13H2,2-6H3/t14-,15-/m1/s1.
What are the key properties of prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(3-hydroxyprop-1-enyl)pyrrolidine-1-carboxylate?
prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(3-hydroxyprop-1-enyl)pyrrolidine-1-carboxylate has a molecular weight of 341.52 g/mol, XLogP of 3.32, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(3-hydroxyprop-1-enyl)pyrrolidine-1-carboxylate is sourced from PubChem (CID 56981485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).