C23H41N — CID 56981493
2,11-di(hexan-3-yl)-1-azacyclododeca-4,8,12-triene (PubChem CID 56981493) has the molecular formula C23H41N and a molecular weight of 331.59 g/mol. Its IUPAC name is 2,11-di(hexan-3-yl)-1-azacyclododeca-4,8,12-triene.
| Compound Name | 2,11-di(hexan-3-yl)-1-azacyclododeca-4,8,12-triene |
|---|---|
| PubChem CID | 56981493 |
| Molecular Formula | C23H41N |
| Molecular Weight | 331.59 g/mol |
| Exact Mass | 331.32 |
| IUPAC Name | 2,11-di(hexan-3-yl)-1-azacyclododeca-4,8,12-triene |
| SMILES | CCCC(CC)C1/C=N\C(C(CC)CCC)CC=CCCC=CC1 |
| InChI | InChI=1S/C23H41N/c1-5-15-20(7-3)22-17-13-11-9-10-12-14-18-23(24-19-22)21(8-4)16-6-2/h11-14,19-23H,5-10,15-18H2,1-4H3/b13-11?,14-12?,24-19- |
| InChIKey | BHGHCBCZYUZOIL-XYMKJICLSA-N |
| XLogP | 7.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.59 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|