C16H19N3O5S — CID 56981612
(6S,7R)-7-[[2-(cyclohex-3-en-1-ylideneamino)acetyl]amino]-3-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 56981612) has the molecular formula C16H19N3O5S and a molecular weight of 365.41 g/mol. Its IUPAC name is (6S,7R)-7-[[2-(cyclohex-3-en-1-ylideneamino)acetyl]amino]-3-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S,7R)-7-[[2-(cyclohex-3-en-1-ylideneamino)acetyl]amino]-3-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 56981612 |
| Molecular Formula | C16H19N3O5S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | (6S,7R)-7-[[2-(cyclohex-3-en-1-ylideneamino)acetyl]amino]-3-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | COC1=C(C(=O)O)N2C(=O)[C@@H](NC(=O)C/N=C3/CC=CCC3)[C@@H]2SC1 |
| InChI | InChI=1S/C16H19N3O5S/c1-24-10-8-25-15-12(14(21)19(15)13(10)16(22)23)18-11(20)7-17-9-5-3-2-4-6-9/h2-3,12,15H,4-8H2,1H3,(H,18,20)(H,22,23)/b17-9-/t12-,15+/m1/s1 |
| InChIKey | SFWVAHAVNWMQTF-PHRPIIOLSA-N |
| XLogP | 0.51 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|