C52H54N4O5 — CID 56981740
benzyl (5S)-6-[[(2S)-4-amino-1-naphthalen-2-yl-4-oxobutan-2-yl]-pentylamino]-5-[[1-(naphthalen-1-ylmethyl)indole-3-carbonyl]amino]-6-oxohexanoate (PubChem CID 56981740) has the molecular formula C52H54N4O5 and a molecular weight of 815.03 g/mol. Its IUPAC name is benzyl (5S)-6-[[(2S)-4-amino-1-naphthalen-2-yl-4-oxobutan-2-yl]-pentylamino]-5-[[1-(naphthalen-1-ylmethyl)indole-3-carbonyl]amino]-6-oxohexanoate.
| Compound Name | benzyl (5S)-6-[[(2S)-4-amino-1-naphthalen-2-yl-4-oxobutan-2-yl]-pentylamino]-5-[[1-(naphthalen-1-ylmethyl)indole-3-carbonyl]amino]-6-oxohexanoate |
|---|---|
| PubChem CID | 56981740 |
| Molecular Formula | C52H54N4O5 |
| Molecular Weight | 815.03 g/mol |
| Exact Mass | 814.41 |
| IUPAC Name | benzyl (5S)-6-[[(2S)-4-amino-1-naphthalen-2-yl-4-oxobutan-2-yl]-pentylamino]-5-[[1-(naphthalen-1-ylmethyl)indole-3-carbonyl]amino]-6-oxohexanoate |
| SMILES | CCCCCN(C(=O)[C@H](CCCC(=O)OCc1ccccc1)NC(=O)c1cn(Cc2cccc3ccccc23)c2ccccc12)[C@H](CC(N)=O)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C52H54N4O5/c1-2-3-13-30-56(43(33-49(53)57)32-38-28-29-39-18-7-8-20-41(39)31-38)52(60)47(25-15-27-50(58)61-36-37-16-5-4-6-17-37)54-51(59)46-35-55(48-26-12-11-24-45(46)48)34-42-22-14-21-40-19-9-10-23-44(40)42/h4-12,14,16-24,26,28-29,31,35,43,47H,2-3,13,15,25,27,30,32-34,36H2,1H3,(H2,53,57)(H,54,59)/t43-,47-/m0/s1 |
| InChIKey | ZFRPKOCECIVKSP-ZUFNAWNRSA-N |
| XLogP | 9.51 |
| TPSA | 123.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.03 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|