C27H36N2O6 — CID 56981741
diethyl 6-methyl-2-(methyliminomethyl)-4-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]phenyl]-2,3,4,5-tetrahydropyridine-3,5-dicarboxylate (PubChem CID 56981741) has the molecular formula C27H36N2O6 and a molecular weight of 484.59 g/mol. Its IUPAC name is diethyl 6-methyl-2-(methyliminomethyl)-4-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]phenyl]-2,3,4,5-tetrahydropyridine-3,5-dicarboxylate.
| Compound Name | diethyl 6-methyl-2-(methyliminomethyl)-4-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]phenyl]-2,3,4,5-tetrahydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 56981741 |
| Molecular Formula | C27H36N2O6 |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | diethyl 6-methyl-2-(methyliminomethyl)-4-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]phenyl]-2,3,4,5-tetrahydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1C(C)=NC(/C=N/C)C(C(=O)OCC)C1c1ccccc1C=CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H36N2O6/c1-8-33-25(31)22-17(3)29-20(16-28-7)24(26(32)34-9-2)23(22)19-13-11-10-12-18(19)14-15-21(30)35-27(4,5)6/h10-16,20,22-24H,8-9H2,1-7H3/b15-14?,28-16+ |
| InChIKey | GEVVMSUYAHOTET-VLKHXHAYSA-N |
| XLogP | 4.03 |
| TPSA | 103.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|