C10H12O6 — CID 56981812
dimethyl 6-hydroxy-3-oxocyclohexene-1,4-dicarboxylate (PubChem CID 56981812) has the molecular formula C10H12O6 and a molecular weight of 228.20 g/mol. Its IUPAC name is dimethyl 6-hydroxy-3-oxocyclohexene-1,4-dicarboxylate.
| Compound Name | dimethyl 6-hydroxy-3-oxocyclohexene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 56981812 |
| Molecular Formula | C10H12O6 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | dimethyl 6-hydroxy-3-oxocyclohexene-1,4-dicarboxylate |
| SMILES | COC(=O)C1=CC(=O)C(C(=O)OC)CC1O |
| InChI | InChI=1S/C10H12O6/c1-15-9(13)5-3-8(12)6(4-7(5)11)10(14)16-2/h3,6-7,11H,4H2,1-2H3 |
| InChIKey | FAIOZSIEXGCVEE-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|