C10H10BrNO2 — CID 56982022
[3-(4-bromophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methanol (PubChem CID 56982022) has the molecular formula C10H10BrNO2 and a molecular weight of 256.10 g/mol. Its IUPAC name is [3-(4-bromophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methanol.
| Compound Name | [3-(4-bromophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methanol |
|---|---|
| PubChem CID | 56982022 |
| Molecular Formula | C10H10BrNO2 |
| Molecular Weight | 256.10 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | [3-(4-bromophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methanol |
| SMILES | OCC1C=C(c2ccc(Br)cc2)NO1 |
| InChI | InChI=1S/C10H10BrNO2/c11-8-3-1-7(2-4-8)10-5-9(6-13)14-12-10/h1-5,9,12-13H,6H2 |
| InChIKey | CAWNXRZKTRNNJY-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.10 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |