About [3-(4-bromophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methanol
[3-(4-bromophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methanol (PubChem CID 56982022) has the molecular formula C10H10BrNO2
and a molecular weight of 256.10 g/mol. Its IUPAC name is [3-(4-bromophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methanol.
Molecular Properties
| Compound Name | [3-(4-bromophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methanol |
| PubChem CID | 56982022 |
| Molecular Formula | C10H10BrNO2 |
| Molecular Weight | 256.10 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | [3-(4-bromophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methanol |
| SMILES | OCC1C=C(c2ccc(Br)cc2)NO1 |
| InChI | InChI=1S/C10H10BrNO2/c11-8-3-1-7(2-4-8)10-5-9(6-13)14-12-10/h1-5,9,12-13H,6H2 |
| InChIKey | CAWNXRZKTRNNJY-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.10 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-(4-bromophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-bromophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methanol?
The IUPAC name of [3-(4-bromophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methanol (CID 56982022) is [3-(4-bromophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methanol.
What is the SMILES notation for [3-(4-bromophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methanol?
The canonical SMILES for [3-(4-bromophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methanol is OCC1C=C(c2ccc(Br)cc2)NO1.
What is the InChIKey of [3-(4-bromophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methanol?
The InChIKey is CAWNXRZKTRNNJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrNO2/c11-8-3-1-7(2-4-8)10-5-9(6-13)14-12-10/h1-5,9,12-13H,6H2.
What are the key properties of [3-(4-bromophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methanol?
[3-(4-bromophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methanol has a molecular weight of 256.10 g/mol, XLogP of 1.69, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-bromophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methanol is sourced from PubChem (CID 56982022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).