About [(7-methoxy-2,2,8-trimethyl-3H-chromen-4-ylidene)amino]urea
[(7-methoxy-2,2,8-trimethyl-3H-chromen-4-ylidene)amino]urea (PubChem CID 56982175) has the molecular formula C14H19N3O3
and a molecular weight of 277.32 g/mol. Its IUPAC name is [(7-methoxy-2,2,8-trimethyl-3H-chromen-4-ylidene)amino]urea.
Molecular Properties
| Compound Name | [(7-methoxy-2,2,8-trimethyl-3H-chromen-4-ylidene)amino]urea |
| PubChem CID | 56982175 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | [(7-methoxy-2,2,8-trimethyl-3H-chromen-4-ylidene)amino]urea |
| SMILES | COc1ccc2c(c1C)OC(C)(C)CC2=NNC(N)=O |
| InChI | InChI=1S/C14H19N3O3/c1-8-11(19-4)6-5-9-10(16-17-13(15)18)7-14(2,3)20-12(8)9/h5-6H,7H2,1-4H3,(H3,15,17,18) |
| InChIKey | HLWYHEXMMVZEKU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(7-methoxy-2,2,8-trimethyl-3H-chromen-4-ylidene)amino]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(7-methoxy-2,2,8-trimethyl-3H-chromen-4-ylidene)amino]urea?
The IUPAC name of [(7-methoxy-2,2,8-trimethyl-3H-chromen-4-ylidene)amino]urea (CID 56982175) is [(7-methoxy-2,2,8-trimethyl-3H-chromen-4-ylidene)amino]urea.
What is the SMILES notation for [(7-methoxy-2,2,8-trimethyl-3H-chromen-4-ylidene)amino]urea?
The canonical SMILES for [(7-methoxy-2,2,8-trimethyl-3H-chromen-4-ylidene)amino]urea is COc1ccc2c(c1C)OC(C)(C)CC2=NNC(N)=O.
What is the InChIKey of [(7-methoxy-2,2,8-trimethyl-3H-chromen-4-ylidene)amino]urea?
The InChIKey is HLWYHEXMMVZEKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O3/c1-8-11(19-4)6-5-9-10(16-17-13(15)18)7-14(2,3)20-12(8)9/h5-6H,7H2,1-4H3,(H3,15,17,18).
What are the key properties of [(7-methoxy-2,2,8-trimethyl-3H-chromen-4-ylidene)amino]urea?
[(7-methoxy-2,2,8-trimethyl-3H-chromen-4-ylidene)amino]urea has a molecular weight of 277.32 g/mol, XLogP of 1.94, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(7-methoxy-2,2,8-trimethyl-3H-chromen-4-ylidene)amino]urea is sourced from PubChem (CID 56982175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).