C20H34N2O2 — CID 56982223
tert-butyl 4-amino-4-(3-pyridin-3-ylpropyl)octanoate (PubChem CID 56982223) has the molecular formula C20H34N2O2 and a molecular weight of 334.50 g/mol. Its IUPAC name is tert-butyl 4-amino-4-(3-pyridin-3-ylpropyl)octanoate.
| Compound Name | tert-butyl 4-amino-4-(3-pyridin-3-ylpropyl)octanoate |
|---|---|
| PubChem CID | 56982223 |
| Molecular Formula | C20H34N2O2 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.26 |
| IUPAC Name | tert-butyl 4-amino-4-(3-pyridin-3-ylpropyl)octanoate |
| SMILES | CCCCC(N)(CCCc1cccnc1)CCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H34N2O2/c1-5-6-12-20(21,14-11-18(23)24-19(2,3)4)13-7-9-17-10-8-15-22-16-17/h8,10,15-16H,5-7,9,11-14,21H2,1-4H3 |
| InChIKey | RZUFZXIEMXWEDO-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |