C27H32O — CID 56982487
(8R,9S,10R,11S,13S,14S)-13-methyl-11-[2-(3-methylphenyl)ethynyl]-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 56982487) has the molecular formula C27H32O and a molecular weight of 372.55 g/mol. Its IUPAC name is (8R,9S,10R,11S,13S,14S)-13-methyl-11-[2-(3-methylphenyl)ethynyl]-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10R,11S,13S,14S)-13-methyl-11-[2-(3-methylphenyl)ethynyl]-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 56982487 |
| Molecular Formula | C27H32O |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | (8R,9S,10R,11S,13S,14S)-13-methyl-11-[2-(3-methylphenyl)ethynyl]-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | Cc1cccc(C#C[C@H]2C[C@]3(C)CCC[C@H]3[C@@H]3CCC4=CC(=O)CC[C@@H]4[C@H]32)c1 |
| InChI | InChI=1S/C27H32O/c1-18-5-3-6-19(15-18)8-9-21-17-27(2)14-4-7-25(27)24-12-10-20-16-22(28)11-13-23(20)26(21)24/h3,5-6,15-16,21,23-26H,4,7,10-14,17H2,1-2H3/t21-,23-,24-,25-,26+,27-/m0/s1 |
| InChIKey | CLMNGFXJTLILBM-ROEKMXJKSA-N |
| XLogP | 6.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|