C13H16F3NO3S2 — CID 56982576
1,1,1-trifluoro-N-[(2-propyl-3,4-dihydro-2H-chromen-4-yl)sulfanyl]methanesulfonamide (PubChem CID 56982576) has the molecular formula C13H16F3NO3S2 and a molecular weight of 355.40 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[(2-propyl-3,4-dihydro-2H-chromen-4-yl)sulfanyl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[(2-propyl-3,4-dihydro-2H-chromen-4-yl)sulfanyl]methanesulfonamide |
|---|---|
| PubChem CID | 56982576 |
| Molecular Formula | C13H16F3NO3S2 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | 1,1,1-trifluoro-N-[(2-propyl-3,4-dihydro-2H-chromen-4-yl)sulfanyl]methanesulfonamide |
| SMILES | CCCC1CC(SNS(=O)(=O)C(F)(F)F)c2ccccc2O1 |
| InChI | InChI=1S/C13H16F3NO3S2/c1-2-5-9-8-12(10-6-3-4-7-11(10)20-9)21-17-22(18,19)13(14,15)16/h3-4,6-7,9,12,17H,2,5,8H2,1H3 |
| InChIKey | YDBYJRMQZJGICQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|