C10H14O5 — CID 56983167
2-[(1S,2S,3S,5R)-3,5-dihydroxy-2-(3-oxoprop-1-enyl)cyclopentyl]acetic acid (PubChem CID 56983167) has the molecular formula C10H14O5 and a molecular weight of 214.22 g/mol. Its IUPAC name is 2-[(1S,2S,3S,5R)-3,5-dihydroxy-2-(3-oxoprop-1-enyl)cyclopentyl]acetic acid.
| Compound Name | 2-[(1S,2S,3S,5R)-3,5-dihydroxy-2-(3-oxoprop-1-enyl)cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 56983167 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 2-[(1S,2S,3S,5R)-3,5-dihydroxy-2-(3-oxoprop-1-enyl)cyclopentyl]acetic acid |
| SMILES | O=CC=C[C@H]1[C@H](CC(=O)O)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C10H14O5/c11-3-1-2-6-7(4-10(14)15)9(13)5-8(6)12/h1-3,6-9,12-13H,4-5H2,(H,14,15)/t6-,7-,8-,9+/m0/s1 |
| InChIKey | AZNZYQFJBBPJNK-XSPKLOCKSA-N |
| XLogP | -0.43 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|