C25H26N4O7 — CID 56983186
4-(3,4-dimethoxyphenyl)-3-(3-ethoxydioxiran-3-yl)-6,7-dimethoxy-2-(1,2,4-triazol-1-ylmethyl)quinoline (PubChem CID 56983186) has the molecular formula C25H26N4O7 and a molecular weight of 494.50 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-3-(3-ethoxydioxiran-3-yl)-6,7-dimethoxy-2-(1,2,4-triazol-1-ylmethyl)quinoline.
| Compound Name | 4-(3,4-dimethoxyphenyl)-3-(3-ethoxydioxiran-3-yl)-6,7-dimethoxy-2-(1,2,4-triazol-1-ylmethyl)quinoline |
|---|---|
| PubChem CID | 56983186 |
| Molecular Formula | C25H26N4O7 |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-3-(3-ethoxydioxiran-3-yl)-6,7-dimethoxy-2-(1,2,4-triazol-1-ylmethyl)quinoline |
| SMILES | CCOC1(c2c(Cn3cncn3)nc3cc(OC)c(OC)cc3c2-c2ccc(OC)c(OC)c2)OO1 |
| InChI | InChI=1S/C25H26N4O7/c1-6-34-25(35-36-25)24-18(12-29-14-26-13-27-29)28-17-11-22(33-5)21(32-4)10-16(17)23(24)15-7-8-19(30-2)20(9-15)31-3/h7-11,13-14H,6,12H2,1-5H3 |
| InChIKey | RJYNMLRTMNNMKC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 114.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|