C25H40O8 — CID 56983241
[2-methyl-10-oxo-7,8-di(pentanoyloxy)-2,3,4,7,8,9-hexahydrooxecin-4-yl] pentanoate (PubChem CID 56983241) has the molecular formula C25H40O8 and a molecular weight of 468.59 g/mol. Its IUPAC name is [2-methyl-10-oxo-7,8-di(pentanoyloxy)-2,3,4,7,8,9-hexahydrooxecin-4-yl] pentanoate.
| Compound Name | [2-methyl-10-oxo-7,8-di(pentanoyloxy)-2,3,4,7,8,9-hexahydrooxecin-4-yl] pentanoate |
|---|---|
| PubChem CID | 56983241 |
| Molecular Formula | C25H40O8 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | [2-methyl-10-oxo-7,8-di(pentanoyloxy)-2,3,4,7,8,9-hexahydrooxecin-4-yl] pentanoate |
| SMILES | CCCCC(=O)OC1C=CC(OC(=O)CCCC)C(OC(=O)CCCC)CC(=O)OC(C)C1 |
| InChI | InChI=1S/C25H40O8/c1-5-8-11-22(26)31-19-14-15-20(32-23(27)12-9-6-2)21(33-24(28)13-10-7-3)17-25(29)30-18(4)16-19/h14-15,18-21H,5-13,16-17H2,1-4H3 |
| InChIKey | QDAQKUKZVSOXKD-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|