C11H9N3O3 — CID 56983272
6-(4-ethenylphenoxy)-1H-1,3,5-triazine-2,4-dione (PubChem CID 56983272) has the molecular formula C11H9N3O3 and a molecular weight of 231.21 g/mol. Its IUPAC name is 6-(4-ethenylphenoxy)-1H-1,3,5-triazine-2,4-dione.
| Compound Name | 6-(4-ethenylphenoxy)-1H-1,3,5-triazine-2,4-dione |
|---|---|
| PubChem CID | 56983272 |
| Molecular Formula | C11H9N3O3 |
| Molecular Weight | 231.21 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 6-(4-ethenylphenoxy)-1H-1,3,5-triazine-2,4-dione |
| SMILES | C=Cc1ccc(Oc2nc(=O)[nH]c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C11H9N3O3/c1-2-7-3-5-8(6-4-7)17-11-13-9(15)12-10(16)14-11/h2-6H,1H2,(H2,12,13,14,15,16) |
| InChIKey | MHTPQPJJBFRPTO-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.21 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |