C7H11N3 — CID 56983375
2,3,4,4a,5,8-hexahydropyrido[2,3-d]pyrimidine (PubChem CID 56983375) has the molecular formula C7H11N3 and a molecular weight of 137.19 g/mol. Its IUPAC name is 2,3,4,4a,5,8-hexahydropyrido[2,3-d]pyrimidine.
| Compound Name | 2,3,4,4a,5,8-hexahydropyrido[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 56983375 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | 2,3,4,4a,5,8-hexahydropyrido[2,3-d]pyrimidine |
| SMILES | C1=CNC2=NCNCC2C1 |
| InChI | InChI=1S/C7H11N3/c1-2-6-4-8-5-10-7(6)9-3-1/h1,3,6,8H,2,4-5H2,(H,9,10) |
| InChIKey | JTXLKFQJGRLUPD-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |