About (3R,6S)-3-methyl-6-nonyl-3,6-dihydro-2H-pyran-5-carbaldehyde
(3R,6S)-3-methyl-6-nonyl-3,6-dihydro-2H-pyran-5-carbaldehyde (PubChem CID 56983627) has the molecular formula C16H28O2
and a molecular weight of 252.40 g/mol. Its IUPAC name is (3R,6S)-3-methyl-6-nonyl-3,6-dihydro-2H-pyran-5-carbaldehyde.
Molecular Properties
| Compound Name | (3R,6S)-3-methyl-6-nonyl-3,6-dihydro-2H-pyran-5-carbaldehyde |
| PubChem CID | 56983627 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | (3R,6S)-3-methyl-6-nonyl-3,6-dihydro-2H-pyran-5-carbaldehyde |
| SMILES | CCCCCCCCC[C@@H]1OC[C@H](C)C=C1C=O |
| InChI | InChI=1S/C16H28O2/c1-3-4-5-6-7-8-9-10-16-15(12-17)11-14(2)13-18-16/h11-12,14,16H,3-10,13H2,1-2H3/t14-,16+/m1/s1 |
| InChIKey | OOQCPBNPRBKOLA-ZBFHGGJFSA-N |
| XLogP | 4.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3R,6S)-3-methyl-6-nonyl-3,6-dihydro-2H-pyran-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,6S)-3-methyl-6-nonyl-3,6-dihydro-2H-pyran-5-carbaldehyde?
The IUPAC name of (3R,6S)-3-methyl-6-nonyl-3,6-dihydro-2H-pyran-5-carbaldehyde (CID 56983627) is (3R,6S)-3-methyl-6-nonyl-3,6-dihydro-2H-pyran-5-carbaldehyde.
What is the SMILES notation for (3R,6S)-3-methyl-6-nonyl-3,6-dihydro-2H-pyran-5-carbaldehyde?
The canonical SMILES for (3R,6S)-3-methyl-6-nonyl-3,6-dihydro-2H-pyran-5-carbaldehyde is CCCCCCCCC[C@@H]1OC[C@H](C)C=C1C=O.
What is the InChIKey of (3R,6S)-3-methyl-6-nonyl-3,6-dihydro-2H-pyran-5-carbaldehyde?
The InChIKey is OOQCPBNPRBKOLA-ZBFHGGJFSA-N. The full InChI is InChI=1S/C16H28O2/c1-3-4-5-6-7-8-9-10-16-15(12-17)11-14(2)13-18-16/h11-12,14,16H,3-10,13H2,1-2H3/t14-,16+/m1/s1.
What are the key properties of (3R,6S)-3-methyl-6-nonyl-3,6-dihydro-2H-pyran-5-carbaldehyde?
(3R,6S)-3-methyl-6-nonyl-3,6-dihydro-2H-pyran-5-carbaldehyde has a molecular weight of 252.40 g/mol, XLogP of 4.29, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,6S)-3-methyl-6-nonyl-3,6-dihydro-2H-pyran-5-carbaldehyde is sourced from PubChem (CID 56983627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).