About 5-benzhydrylidene-1,3-diphenyl-6-sulfanylidene-1,3-diazinane-2,4-dione
5-benzhydrylidene-1,3-diphenyl-6-sulfanylidene-1,3-diazinane-2,4-dione (PubChem CID 56984033) has the molecular formula C29H20N2O2S
and a molecular weight of 460.56 g/mol. Its IUPAC name is 5-benzhydrylidene-1,3-diphenyl-6-sulfanylidene-1,3-diazinane-2,4-dione.
Molecular Properties
| Compound Name | 5-benzhydrylidene-1,3-diphenyl-6-sulfanylidene-1,3-diazinane-2,4-dione |
| PubChem CID | 56984033 |
| Molecular Formula | C29H20N2O2S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 5-benzhydrylidene-1,3-diphenyl-6-sulfanylidene-1,3-diazinane-2,4-dione |
| SMILES | O=C1C(=C(c2ccccc2)c2ccccc2)C(=S)N(c2ccccc2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C29H20N2O2S/c32-27-26(25(21-13-5-1-6-14-21)22-15-7-2-8-16-22)28(34)31(24-19-11-4-12-20-24)29(33)30(27)23-17-9-3-10-18-23/h1-20H |
| InChIKey | OPSRGCGUIBXKQX-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-benzhydrylidene-1,3-diphenyl-6-sulfanylidene-1,3-diazinane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzhydrylidene-1,3-diphenyl-6-sulfanylidene-1,3-diazinane-2,4-dione?
The IUPAC name of 5-benzhydrylidene-1,3-diphenyl-6-sulfanylidene-1,3-diazinane-2,4-dione (CID 56984033) is 5-benzhydrylidene-1,3-diphenyl-6-sulfanylidene-1,3-diazinane-2,4-dione.
What is the SMILES notation for 5-benzhydrylidene-1,3-diphenyl-6-sulfanylidene-1,3-diazinane-2,4-dione?
The canonical SMILES for 5-benzhydrylidene-1,3-diphenyl-6-sulfanylidene-1,3-diazinane-2,4-dione is O=C1C(=C(c2ccccc2)c2ccccc2)C(=S)N(c2ccccc2)C(=O)N1c1ccccc1.
What is the InChIKey of 5-benzhydrylidene-1,3-diphenyl-6-sulfanylidene-1,3-diazinane-2,4-dione?
The InChIKey is OPSRGCGUIBXKQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H20N2O2S/c32-27-26(25(21-13-5-1-6-14-21)22-15-7-2-8-16-22)28(34)31(24-19-11-4-12-20-24)29(33)30(27)23-17-9-3-10-18-23/h1-20H.
What are the key properties of 5-benzhydrylidene-1,3-diphenyl-6-sulfanylidene-1,3-diazinane-2,4-dione?
5-benzhydrylidene-1,3-diphenyl-6-sulfanylidene-1,3-diazinane-2,4-dione has a molecular weight of 460.56 g/mol, XLogP of 6.49, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzhydrylidene-1,3-diphenyl-6-sulfanylidene-1,3-diazinane-2,4-dione is sourced from PubChem (CID 56984033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).