C21H30F2 — CID 56984044
7-but-2-enyl-6-(2,2-difluoroethenyl)-8-ethenyl-5-methyldodeca-2,4,10-triene (PubChem CID 56984044) has the molecular formula C21H30F2 and a molecular weight of 320.47 g/mol. Its IUPAC name is 7-but-2-enyl-6-(2,2-difluoroethenyl)-8-ethenyl-5-methyldodeca-2,4,10-triene.
| Compound Name | 7-but-2-enyl-6-(2,2-difluoroethenyl)-8-ethenyl-5-methyldodeca-2,4,10-triene |
|---|---|
| PubChem CID | 56984044 |
| Molecular Formula | C21H30F2 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | 7-but-2-enyl-6-(2,2-difluoroethenyl)-8-ethenyl-5-methyldodeca-2,4,10-triene |
| SMILES | C=CC(CC=CC)C(CC=CC)C(C=C(F)F)C(C)=CC=CC |
| InChI | InChI=1S/C21H30F2/c1-6-10-13-17(5)20(16-21(22)23)19(15-12-8-3)18(9-4)14-11-7-2/h6-13,16,18-20H,4,14-15H2,1-3,5H3 |
| InChIKey | OWFMZTFJUNQOKY-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|