C15H20 — CID 56984117
4,5,10-trimethyldodeca-5,6-dien-1,11-diyne (PubChem CID 56984117) has the molecular formula C15H20 and a molecular weight of 200.32 g/mol. Its IUPAC name is 4,5,10-trimethyldodeca-5,6-dien-1,11-diyne.
| Compound Name | 4,5,10-trimethyldodeca-5,6-dien-1,11-diyne |
|---|---|
| PubChem CID | 56984117 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 4,5,10-trimethyldodeca-5,6-dien-1,11-diyne |
| SMILES | C#CCC(C)C(C)=C=CCCC(C)C#C |
| InChI | InChI=1S/C15H20/c1-6-10-14(4)15(5)12-9-8-11-13(3)7-2/h1-2,9,13-14H,8,10-11H2,3-5H3 |
| InChIKey | CNIQSLVXJVOJQX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|