About 1,6-diethoxyhexa-1,5-diene-3,4-dione
1,6-diethoxyhexa-1,5-diene-3,4-dione (PubChem CID 56984155) has the molecular formula C10H14O4
and a molecular weight of 198.22 g/mol. Its IUPAC name is 1,6-diethoxyhexa-1,5-diene-3,4-dione.
Molecular Properties
| Compound Name | 1,6-diethoxyhexa-1,5-diene-3,4-dione |
| PubChem CID | 56984155 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 1,6-diethoxyhexa-1,5-diene-3,4-dione |
| SMILES | CCOC=CC(=O)C(=O)C=COCC |
| InChI | InChI=1S/C10H14O4/c1-3-13-7-5-9(11)10(12)6-8-14-4-2/h5-8H,3-4H2,1-2H3 |
| InChIKey | LLVBFQQQPHLOKU-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1,6-diethoxyhexa-1,5-diene-3,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-diethoxyhexa-1,5-diene-3,4-dione?
The IUPAC name of 1,6-diethoxyhexa-1,5-diene-3,4-dione (CID 56984155) is 1,6-diethoxyhexa-1,5-diene-3,4-dione.
What is the SMILES notation for 1,6-diethoxyhexa-1,5-diene-3,4-dione?
The canonical SMILES for 1,6-diethoxyhexa-1,5-diene-3,4-dione is CCOC=CC(=O)C(=O)C=COCC.
What is the InChIKey of 1,6-diethoxyhexa-1,5-diene-3,4-dione?
The InChIKey is LLVBFQQQPHLOKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O4/c1-3-13-7-5-9(11)10(12)6-8-14-4-2/h5-8H,3-4H2,1-2H3.
What are the key properties of 1,6-diethoxyhexa-1,5-diene-3,4-dione?
1,6-diethoxyhexa-1,5-diene-3,4-dione has a molecular weight of 198.22 g/mol, XLogP of 1.23, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-diethoxyhexa-1,5-diene-3,4-dione is sourced from PubChem (CID 56984155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).