C26H41FO5 — CID 56984415
(3aS,4R,5R,6aR)-4-[4-fluoro-1-(oxan-2-yloxy)oct-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one (PubChem CID 56984415) has the molecular formula C26H41FO5 and a molecular weight of 452.61 g/mol. Its IUPAC name is (3aS,4R,5R,6aR)-4-[4-fluoro-1-(oxan-2-yloxy)oct-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one.
| Compound Name | (3aS,4R,5R,6aR)-4-[4-fluoro-1-(oxan-2-yloxy)oct-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 56984415 |
| Molecular Formula | C26H41FO5 |
| Molecular Weight | 452.61 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | (3aS,4R,5R,6aR)-4-[4-fluoro-1-(oxan-2-yloxy)oct-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
| SMILES | CCCCC(F)CC=C(OC1CCCCO1)[C@@H]1[C@H]2CC(=O)C[C@H]2C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C26H41FO5/c1-2-3-8-19(27)11-12-22(31-24-9-4-6-13-29-24)26-21-17-20(28)15-18(21)16-23(26)32-25-10-5-7-14-30-25/h12,18-19,21,23-26H,2-11,13-17H2,1H3/t18-,19?,21-,23+,24?,25?,26-/m0/s1 |
| InChIKey | MAGXWHXBYSTQTB-GNLJWTOISA-N |
| XLogP | 5.86 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.61 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|