C17H24O5 — CID 56984546
2-[2-hydroxy-2-(2,2,4-trimethyl-1,3-dioxolan-4-yl)ethyl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione (PubChem CID 56984546) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is 2-[2-hydroxy-2-(2,2,4-trimethyl-1,3-dioxolan-4-yl)ethyl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[2-hydroxy-2-(2,2,4-trimethyl-1,3-dioxolan-4-yl)ethyl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 56984546 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 2-[2-hydroxy-2-(2,2,4-trimethyl-1,3-dioxolan-4-yl)ethyl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=C(C)C(=O)C(CC(O)C2(C)COC(C)(C)O2)=C(C)C1=O |
| InChI | InChI=1S/C17H24O5/c1-9-10(2)15(20)12(11(3)14(9)19)7-13(18)17(6)8-21-16(4,5)22-17/h13,18H,7-8H2,1-6H3 |
| InChIKey | XDXSYCPDYKPDFG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|