About 2-[(1E)-2-methylpenta-1,4-dienyl]benzenethiol
2-[(1E)-2-methylpenta-1,4-dienyl]benzenethiol (PubChem CID 56984915) has the molecular formula C12H14S
and a molecular weight of 190.31 g/mol. Its IUPAC name is 2-[(1E)-2-methylpenta-1,4-dienyl]benzenethiol.
Molecular Properties
| Compound Name | 2-[(1E)-2-methylpenta-1,4-dienyl]benzenethiol |
| PubChem CID | 56984915 |
| Molecular Formula | C12H14S |
| Molecular Weight | 190.31 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | 2-[(1E)-2-methylpenta-1,4-dienyl]benzenethiol |
| SMILES | C=CC/C(C)=C/c1ccccc1S |
| InChI | InChI=1S/C12H14S/c1-3-6-10(2)9-11-7-4-5-8-12(11)13/h3-5,7-9,13H,1,6H2,2H3/b10-9+ |
| InChIKey | ICBOVWOJQZJMFM-MDZDMXLPSA-N |
| XLogP | 3.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.31 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1E)-2-methylpenta-1,4-dienyl]benzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1E)-2-methylpenta-1,4-dienyl]benzenethiol?
The IUPAC name of 2-[(1E)-2-methylpenta-1,4-dienyl]benzenethiol (CID 56984915) is 2-[(1E)-2-methylpenta-1,4-dienyl]benzenethiol.
What is the SMILES notation for 2-[(1E)-2-methylpenta-1,4-dienyl]benzenethiol?
The canonical SMILES for 2-[(1E)-2-methylpenta-1,4-dienyl]benzenethiol is C=CC/C(C)=C/c1ccccc1S.
What is the InChIKey of 2-[(1E)-2-methylpenta-1,4-dienyl]benzenethiol?
The InChIKey is ICBOVWOJQZJMFM-MDZDMXLPSA-N. The full InChI is InChI=1S/C12H14S/c1-3-6-10(2)9-11-7-4-5-8-12(11)13/h3-5,7-9,13H,1,6H2,2H3/b10-9+.
What are the key properties of 2-[(1E)-2-methylpenta-1,4-dienyl]benzenethiol?
2-[(1E)-2-methylpenta-1,4-dienyl]benzenethiol has a molecular weight of 190.31 g/mol, XLogP of 3.95, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1E)-2-methylpenta-1,4-dienyl]benzenethiol is sourced from PubChem (CID 56984915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).