C18H12N6 — CID 56985103
4-[2-(2,5-dicyanophenyl)hydrazinyl]-2,6-dimethylbenzene-1,3-dicarbonitrile (PubChem CID 56985103) has the molecular formula C18H12N6 and a molecular weight of 312.34 g/mol. Its IUPAC name is 4-[2-(2,5-dicyanophenyl)hydrazinyl]-2,6-dimethylbenzene-1,3-dicarbonitrile.
| Compound Name | 4-[2-(2,5-dicyanophenyl)hydrazinyl]-2,6-dimethylbenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 56985103 |
| Molecular Formula | C18H12N6 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 4-[2-(2,5-dicyanophenyl)hydrazinyl]-2,6-dimethylbenzene-1,3-dicarbonitrile |
| SMILES | Cc1cc(NNc2cc(C#N)ccc2C#N)c(C#N)c(C)c1C#N |
| InChI | InChI=1S/C18H12N6/c1-11-5-18(16(10-22)12(2)15(11)9-21)24-23-17-6-13(7-19)3-4-14(17)8-20/h3-6,23-24H,1-2H3 |
| InChIKey | XWUQLYOVEVLNMB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|