About [4-chloro-5-(1,3-dithian-2-yl)-2-fluorophenyl]hydrazine
[4-chloro-5-(1,3-dithian-2-yl)-2-fluorophenyl]hydrazine (PubChem CID 56985422) has the molecular formula C10H12ClFN2S2
and a molecular weight of 278.81 g/mol. Its IUPAC name is [4-chloro-5-(1,3-dithian-2-yl)-2-fluorophenyl]hydrazine.
Molecular Properties
| Compound Name | [4-chloro-5-(1,3-dithian-2-yl)-2-fluorophenyl]hydrazine |
| PubChem CID | 56985422 |
| Molecular Formula | C10H12ClFN2S2 |
| Molecular Weight | 278.81 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | [4-chloro-5-(1,3-dithian-2-yl)-2-fluorophenyl]hydrazine |
| SMILES | NNc1cc(C2SCCCS2)c(Cl)cc1F |
| InChI | InChI=1S/C10H12ClFN2S2/c11-7-5-8(12)9(14-13)4-6(7)10-15-2-1-3-16-10/h4-5,10,14H,1-3,13H2 |
| InChIKey | SKJCAGLYCPWRRA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.81 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-chloro-5-(1,3-dithian-2-yl)-2-fluorophenyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-chloro-5-(1,3-dithian-2-yl)-2-fluorophenyl]hydrazine?
The IUPAC name of [4-chloro-5-(1,3-dithian-2-yl)-2-fluorophenyl]hydrazine (CID 56985422) is [4-chloro-5-(1,3-dithian-2-yl)-2-fluorophenyl]hydrazine.
What is the SMILES notation for [4-chloro-5-(1,3-dithian-2-yl)-2-fluorophenyl]hydrazine?
The canonical SMILES for [4-chloro-5-(1,3-dithian-2-yl)-2-fluorophenyl]hydrazine is NNc1cc(C2SCCCS2)c(Cl)cc1F.
What is the InChIKey of [4-chloro-5-(1,3-dithian-2-yl)-2-fluorophenyl]hydrazine?
The InChIKey is SKJCAGLYCPWRRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClFN2S2/c11-7-5-8(12)9(14-13)4-6(7)10-15-2-1-3-16-10/h4-5,10,14H,1-3,13H2.
What are the key properties of [4-chloro-5-(1,3-dithian-2-yl)-2-fluorophenyl]hydrazine?
[4-chloro-5-(1,3-dithian-2-yl)-2-fluorophenyl]hydrazine has a molecular weight of 278.81 g/mol, XLogP of 3.63, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-chloro-5-(1,3-dithian-2-yl)-2-fluorophenyl]hydrazine is sourced from PubChem (CID 56985422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).