About 4-N-[(2S)-2-methylbutyl]-1,3-thiazole-2,4-diamine
4-N-[(2S)-2-methylbutyl]-1,3-thiazole-2,4-diamine (PubChem CID 56986236) has the molecular formula C8H15N3S
and a molecular weight of 185.30 g/mol. Its IUPAC name is 4-N-[(2S)-2-methylbutyl]-1,3-thiazole-2,4-diamine.
Molecular Properties
| Compound Name | 4-N-[(2S)-2-methylbutyl]-1,3-thiazole-2,4-diamine |
| PubChem CID | 56986236 |
| Molecular Formula | C8H15N3S |
| Molecular Weight | 185.30 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 4-N-[(2S)-2-methylbutyl]-1,3-thiazole-2,4-diamine |
| SMILES | CC[C@H](C)CNc1csc(N)n1 |
| InChI | InChI=1S/C8H15N3S/c1-3-6(2)4-10-7-5-12-8(9)11-7/h5-6,10H,3-4H2,1-2H3,(H2,9,11)/t6-/m0/s1 |
| InChIKey | IKESVOKWRYSWDI-LURJTMIESA-N |
| XLogP | 2.18 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-N-[(2S)-2-methylbutyl]-1,3-thiazole-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-[(2S)-2-methylbutyl]-1,3-thiazole-2,4-diamine?
The IUPAC name of 4-N-[(2S)-2-methylbutyl]-1,3-thiazole-2,4-diamine (CID 56986236) is 4-N-[(2S)-2-methylbutyl]-1,3-thiazole-2,4-diamine.
What is the SMILES notation for 4-N-[(2S)-2-methylbutyl]-1,3-thiazole-2,4-diamine?
The canonical SMILES for 4-N-[(2S)-2-methylbutyl]-1,3-thiazole-2,4-diamine is CC[C@H](C)CNc1csc(N)n1.
What is the InChIKey of 4-N-[(2S)-2-methylbutyl]-1,3-thiazole-2,4-diamine?
The InChIKey is IKESVOKWRYSWDI-LURJTMIESA-N. The full InChI is InChI=1S/C8H15N3S/c1-3-6(2)4-10-7-5-12-8(9)11-7/h5-6,10H,3-4H2,1-2H3,(H2,9,11)/t6-/m0/s1.
What are the key properties of 4-N-[(2S)-2-methylbutyl]-1,3-thiazole-2,4-diamine?
4-N-[(2S)-2-methylbutyl]-1,3-thiazole-2,4-diamine has a molecular weight of 185.30 g/mol, XLogP of 2.18, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-[(2S)-2-methylbutyl]-1,3-thiazole-2,4-diamine is sourced from PubChem (CID 56986236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).