C39H44F2N2O2 — CID 56986292
N-[7-(6-fluoro-7-methoxy-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-4,4-diphenylheptyl]-3-(4-fluorophenyl)propanamide (PubChem CID 56986292) has the molecular formula C39H44F2N2O2 and a molecular weight of 610.79 g/mol. Its IUPAC name is N-[7-(6-fluoro-7-methoxy-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-4,4-diphenylheptyl]-3-(4-fluorophenyl)propanamide.
| Compound Name | N-[7-(6-fluoro-7-methoxy-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-4,4-diphenylheptyl]-3-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 56986292 |
| Molecular Formula | C39H44F2N2O2 |
| Molecular Weight | 610.79 g/mol |
| Exact Mass | 610.34 |
| IUPAC Name | N-[7-(6-fluoro-7-methoxy-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-4,4-diphenylheptyl]-3-(4-fluorophenyl)propanamide |
| SMILES | COc1cc2c(cc1F)CCN(CCCC(CCCNC(=O)CCc1ccc(F)cc1)(c1ccccc1)c1ccccc1)C2C |
| InChI | InChI=1S/C39H44F2N2O2/c1-29-35-28-37(45-2)36(41)27-31(35)21-26-43(29)25-10-23-39(32-11-5-3-6-12-32,33-13-7-4-8-14-33)22-9-24-42-38(44)20-17-30-15-18-34(40)19-16-30/h3-8,11-16,18-19,27-29H,9-10,17,20-26H2,1-2H3,(H,42,44) |
| InChIKey | PKWZKUUWBYANBG-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.79 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|