About (5S)-1-cyclohexyl-5-(3,4-difluorophenyl)-5-(1,3-dioxolan-2-ylmethyl)piperidin-2-one
(5S)-1-cyclohexyl-5-(3,4-difluorophenyl)-5-(1,3-dioxolan-2-ylmethyl)piperidin-2-one (PubChem CID 56986519) has the molecular formula C21H27F2NO3
and a molecular weight of 379.45 g/mol. Its IUPAC name is (5S)-1-cyclohexyl-5-(3,4-difluorophenyl)-5-(1,3-dioxolan-2-ylmethyl)piperidin-2-one.
Molecular Properties
| Compound Name | (5S)-1-cyclohexyl-5-(3,4-difluorophenyl)-5-(1,3-dioxolan-2-ylmethyl)piperidin-2-one |
| PubChem CID | 56986519 |
| Molecular Formula | C21H27F2NO3 |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | (5S)-1-cyclohexyl-5-(3,4-difluorophenyl)-5-(1,3-dioxolan-2-ylmethyl)piperidin-2-one |
| SMILES | O=C1CC[C@](CC2OCCO2)(c2ccc(F)c(F)c2)CN1C1CCCCC1 |
| InChI | InChI=1S/C21H27F2NO3/c22-17-7-6-15(12-18(17)23)21(13-20-26-10-11-27-20)9-8-19(25)24(14-21)16-4-2-1-3-5-16/h6-7,12,16,20H,1-5,8-11,13-14H2/t21-/m1/s1 |
| InChIKey | VIFRCRPWVXNFMB-OAQYLSRUSA-N |
| XLogP | 3.92 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5S)-1-cyclohexyl-5-(3,4-difluorophenyl)-5-(1,3-dioxolan-2-ylmethyl)piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-1-cyclohexyl-5-(3,4-difluorophenyl)-5-(1,3-dioxolan-2-ylmethyl)piperidin-2-one?
The IUPAC name of (5S)-1-cyclohexyl-5-(3,4-difluorophenyl)-5-(1,3-dioxolan-2-ylmethyl)piperidin-2-one (CID 56986519) is (5S)-1-cyclohexyl-5-(3,4-difluorophenyl)-5-(1,3-dioxolan-2-ylmethyl)piperidin-2-one.
What is the SMILES notation for (5S)-1-cyclohexyl-5-(3,4-difluorophenyl)-5-(1,3-dioxolan-2-ylmethyl)piperidin-2-one?
The canonical SMILES for (5S)-1-cyclohexyl-5-(3,4-difluorophenyl)-5-(1,3-dioxolan-2-ylmethyl)piperidin-2-one is O=C1CC[C@](CC2OCCO2)(c2ccc(F)c(F)c2)CN1C1CCCCC1.
What is the InChIKey of (5S)-1-cyclohexyl-5-(3,4-difluorophenyl)-5-(1,3-dioxolan-2-ylmethyl)piperidin-2-one?
The InChIKey is VIFRCRPWVXNFMB-OAQYLSRUSA-N. The full InChI is InChI=1S/C21H27F2NO3/c22-17-7-6-15(12-18(17)23)21(13-20-26-10-11-27-20)9-8-19(25)24(14-21)16-4-2-1-3-5-16/h6-7,12,16,20H,1-5,8-11,13-14H2/t21-/m1/s1.
What are the key properties of (5S)-1-cyclohexyl-5-(3,4-difluorophenyl)-5-(1,3-dioxolan-2-ylmethyl)piperidin-2-one?
(5S)-1-cyclohexyl-5-(3,4-difluorophenyl)-5-(1,3-dioxolan-2-ylmethyl)piperidin-2-one has a molecular weight of 379.45 g/mol, XLogP of 3.92, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-1-cyclohexyl-5-(3,4-difluorophenyl)-5-(1,3-dioxolan-2-ylmethyl)piperidin-2-one is sourced from PubChem (CID 56986519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).