About 1-benzyl-3-(7-chloro-3,3-dimethyl-1,4-dihydroisochromen-1-yl)pyridin-2-one
1-benzyl-3-(7-chloro-3,3-dimethyl-1,4-dihydroisochromen-1-yl)pyridin-2-one (PubChem CID 56986577) has the molecular formula C23H22ClNO2
and a molecular weight of 379.89 g/mol. Its IUPAC name is 1-benzyl-3-(7-chloro-3,3-dimethyl-1,4-dihydroisochromen-1-yl)pyridin-2-one.
Molecular Properties
| Compound Name | 1-benzyl-3-(7-chloro-3,3-dimethyl-1,4-dihydroisochromen-1-yl)pyridin-2-one |
| PubChem CID | 56986577 |
| Molecular Formula | C23H22ClNO2 |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 1-benzyl-3-(7-chloro-3,3-dimethyl-1,4-dihydroisochromen-1-yl)pyridin-2-one |
| SMILES | CC1(C)Cc2ccc(Cl)cc2C(c2cccn(Cc3ccccc3)c2=O)O1 |
| InChI | InChI=1S/C23H22ClNO2/c1-23(2)14-17-10-11-18(24)13-20(17)21(27-23)19-9-6-12-25(22(19)26)15-16-7-4-3-5-8-16/h3-13,21H,14-15H2,1-2H3 |
| InChIKey | HYFLAIBYQWTAMW-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-benzyl-3-(7-chloro-3,3-dimethyl-1,4-dihydroisochromen-1-yl)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3-(7-chloro-3,3-dimethyl-1,4-dihydroisochromen-1-yl)pyridin-2-one?
The IUPAC name of 1-benzyl-3-(7-chloro-3,3-dimethyl-1,4-dihydroisochromen-1-yl)pyridin-2-one (CID 56986577) is 1-benzyl-3-(7-chloro-3,3-dimethyl-1,4-dihydroisochromen-1-yl)pyridin-2-one.
What is the SMILES notation for 1-benzyl-3-(7-chloro-3,3-dimethyl-1,4-dihydroisochromen-1-yl)pyridin-2-one?
The canonical SMILES for 1-benzyl-3-(7-chloro-3,3-dimethyl-1,4-dihydroisochromen-1-yl)pyridin-2-one is CC1(C)Cc2ccc(Cl)cc2C(c2cccn(Cc3ccccc3)c2=O)O1.
What is the InChIKey of 1-benzyl-3-(7-chloro-3,3-dimethyl-1,4-dihydroisochromen-1-yl)pyridin-2-one?
The InChIKey is HYFLAIBYQWTAMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22ClNO2/c1-23(2)14-17-10-11-18(24)13-20(17)21(27-23)19-9-6-12-25(22(19)26)15-16-7-4-3-5-8-16/h3-13,21H,14-15H2,1-2H3.
What are the key properties of 1-benzyl-3-(7-chloro-3,3-dimethyl-1,4-dihydroisochromen-1-yl)pyridin-2-one?
1-benzyl-3-(7-chloro-3,3-dimethyl-1,4-dihydroisochromen-1-yl)pyridin-2-one has a molecular weight of 379.89 g/mol, XLogP of 4.99, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3-(7-chloro-3,3-dimethyl-1,4-dihydroisochromen-1-yl)pyridin-2-one is sourced from PubChem (CID 56986577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).