C23H31N3O3 — CID 56986789
2-[(6aR,10aR)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]ethyl morpholine-4-carboxylate (PubChem CID 56986789) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is 2-[(6aR,10aR)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]ethyl morpholine-4-carboxylate.
| Compound Name | 2-[(6aR,10aR)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]ethyl morpholine-4-carboxylate |
|---|---|
| PubChem CID | 56986789 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | 2-[(6aR,10aR)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]ethyl morpholine-4-carboxylate |
| SMILES | CN1CC(CCOC(=O)N2CCOCC2)C[C@@H]2c3cccc4c3c(cn4C)C[C@H]21 |
| InChI | InChI=1S/C23H31N3O3/c1-24-14-16(6-9-29-23(27)26-7-10-28-11-8-26)12-19-18-4-3-5-20-22(18)17(13-21(19)24)15-25(20)2/h3-5,15-16,19,21H,6-14H2,1-2H3/t16?,19-,21-/m1/s1 |
| InChIKey | PXGUCSPBHLRISP-MUVQZQTDSA-N |
| XLogP | 3.00 |
| TPSA | 46.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|