C22H21NO5S — CID 56987796
2-[[6-[naphthalen-2-yl(sulfino)amino]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid (PubChem CID 56987796) has the molecular formula C22H21NO5S and a molecular weight of 411.48 g/mol. Its IUPAC name is 2-[[6-[naphthalen-2-yl(sulfino)amino]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid.
| Compound Name | 2-[[6-[naphthalen-2-yl(sulfino)amino]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 56987796 |
| Molecular Formula | C22H21NO5S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 2-[[6-[naphthalen-2-yl(sulfino)amino]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid |
| SMILES | O=C(O)COc1cccc2c1CCC(N(c1ccc3ccccc3c1)S(=O)O)C2 |
| InChI | InChI=1S/C22H21NO5S/c24-22(25)14-28-21-7-3-6-17-13-19(10-11-20(17)21)23(29(26)27)18-9-8-15-4-1-2-5-16(15)12-18/h1-9,12,19H,10-11,13-14H2,(H,24,25)(H,26,27) |
| InChIKey | LNBMASTWXSUTFU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|