C20H25NO2 — CID 56987870
(8R,9S,10R,13S,14S)-4-imino-10,13-dimethyl-6-methylidene-7,8,9,11,12,14,15,16-octahydro-5H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 56987870) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-4-imino-10,13-dimethyl-6-methylidene-7,8,9,11,12,14,15,16-octahydro-5H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8R,9S,10R,13S,14S)-4-imino-10,13-dimethyl-6-methylidene-7,8,9,11,12,14,15,16-octahydro-5H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 56987870 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | (8R,9S,10R,13S,14S)-4-imino-10,13-dimethyl-6-methylidene-7,8,9,11,12,14,15,16-octahydro-5H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | [H]/N=C1\C(=O)C=C[C@@]2(C)C1C(=C)C[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C20H25NO2/c1-11-10-12-13-4-5-16(23)19(13,2)8-6-14(12)20(3)9-7-15(22)18(21)17(11)20/h7,9,12-14,17,21H,1,4-6,8,10H2,2-3H3/b21-18+/t12-,13-,14-,17?,19-,20+/m0/s1 |
| InChIKey | RNQAXEKLXUPJEO-KXXVZZLGSA-N |
| XLogP | 3.74 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|