C21H20O4S2 — CID 56988064
4-[3-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-7-yl]-3-hydroxyprop-1-ynyl]benzoic acid (PubChem CID 56988064) has the molecular formula C21H20O4S2 and a molecular weight of 400.52 g/mol. Its IUPAC name is 4-[3-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-7-yl]-3-hydroxyprop-1-ynyl]benzoic acid.
| Compound Name | 4-[3-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-7-yl]-3-hydroxyprop-1-ynyl]benzoic acid |
|---|---|
| PubChem CID | 56988064 |
| Molecular Formula | C21H20O4S2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 4-[3-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-7-yl]-3-hydroxyprop-1-ynyl]benzoic acid |
| SMILES | CSC1(SC)CCOc2cc(C(O)C#Cc3ccc(C(=O)O)cc3)ccc21 |
| InChI | InChI=1S/C21H20O4S2/c1-26-21(27-2)11-12-25-19-13-16(8-9-17(19)21)18(22)10-5-14-3-6-15(7-4-14)20(23)24/h3-4,6-9,13,18,22H,11-12H2,1-2H3,(H,23,24) |
| InChIKey | NECMKLLVWZLXOZ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|