About 5-(2,3-dihydroxy-1-oxothiiran-2-yl)-3,4-dihydroxyoxolan-2-one
5-(2,3-dihydroxy-1-oxothiiran-2-yl)-3,4-dihydroxyoxolan-2-one (PubChem CID 56988199) has the molecular formula C6H8O7S
and a molecular weight of 224.19 g/mol. Its IUPAC name is 5-(2,3-dihydroxy-1-oxothiiran-2-yl)-3,4-dihydroxyoxolan-2-one.
Molecular Properties
| Compound Name | 5-(2,3-dihydroxy-1-oxothiiran-2-yl)-3,4-dihydroxyoxolan-2-one |
| PubChem CID | 56988199 |
| Molecular Formula | C6H8O7S |
| Molecular Weight | 224.19 g/mol |
| Exact Mass | 224.00 |
| IUPAC Name | 5-(2,3-dihydroxy-1-oxothiiran-2-yl)-3,4-dihydroxyoxolan-2-one |
| SMILES | O=C1OC(C2(O)C(O)S2=O)C(O)C1O |
| InChI | InChI=1S/C6H8O7S/c7-1-2(8)4(9)13-3(1)6(11)5(10)14(6)12/h1-3,5,7-8,10-11H |
| InChIKey | NSUDDKAHBNNZRU-UHFFFAOYSA-N |
| XLogP | -3.60 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.19 |
| LogP ≤ 5 | -3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,3-dihydroxy-1-oxothiiran-2-yl)-3,4-dihydroxyoxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,3-dihydroxy-1-oxothiiran-2-yl)-3,4-dihydroxyoxolan-2-one?
The IUPAC name of 5-(2,3-dihydroxy-1-oxothiiran-2-yl)-3,4-dihydroxyoxolan-2-one (CID 56988199) is 5-(2,3-dihydroxy-1-oxothiiran-2-yl)-3,4-dihydroxyoxolan-2-one.
What is the SMILES notation for 5-(2,3-dihydroxy-1-oxothiiran-2-yl)-3,4-dihydroxyoxolan-2-one?
The canonical SMILES for 5-(2,3-dihydroxy-1-oxothiiran-2-yl)-3,4-dihydroxyoxolan-2-one is O=C1OC(C2(O)C(O)S2=O)C(O)C1O.
What is the InChIKey of 5-(2,3-dihydroxy-1-oxothiiran-2-yl)-3,4-dihydroxyoxolan-2-one?
The InChIKey is NSUDDKAHBNNZRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O7S/c7-1-2(8)4(9)13-3(1)6(11)5(10)14(6)12/h1-3,5,7-8,10-11H.
What are the key properties of 5-(2,3-dihydroxy-1-oxothiiran-2-yl)-3,4-dihydroxyoxolan-2-one?
5-(2,3-dihydroxy-1-oxothiiran-2-yl)-3,4-dihydroxyoxolan-2-one has a molecular weight of 224.19 g/mol, XLogP of -3.60, 1 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,3-dihydroxy-1-oxothiiran-2-yl)-3,4-dihydroxyoxolan-2-one is sourced from PubChem (CID 56988199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).