C18H21NO4 — CID 56988315
6,7-dimethoxy-9-methyl-2-prop-2-enyl-4,5-dihydrobenzo[e]isoindole-1,3-diol (PubChem CID 56988315) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is 6,7-dimethoxy-9-methyl-2-prop-2-enyl-4,5-dihydrobenzo[e]isoindole-1,3-diol.
| Compound Name | 6,7-dimethoxy-9-methyl-2-prop-2-enyl-4,5-dihydrobenzo[e]isoindole-1,3-diol |
|---|---|
| PubChem CID | 56988315 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 6,7-dimethoxy-9-methyl-2-prop-2-enyl-4,5-dihydrobenzo[e]isoindole-1,3-diol |
| SMILES | C=CCn1c(O)c2c(c1O)-c1c(C)cc(OC)c(OC)c1CC2 |
| InChI | InChI=1S/C18H21NO4/c1-5-8-19-17(20)12-7-6-11-14(15(12)18(19)21)10(2)9-13(22-3)16(11)23-4/h5,9,20-21H,1,6-8H2,2-4H3 |
| InChIKey | IFKUXWAGSLYIDX-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 63.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|